* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JASPLAKINOLIDE |
CAS: | 102396-24-7 |
English Synonyms: | JASPLAKINOLIDE |
MDL Number.: | MFCD00467745 |
H bond acceptor: | 10 |
H bond donor: | 4 |
Smile: | C[C@H](C[C@H](C)O)/C=C(\C)/C[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@@H](Cc1c2ccccc2[nH]c1Br)C(=O)NC3CC(=O)Oc4cccc3c4 |
InChi: | InChI=1S/C36H45BrN4O6/c1-20(14-21(2)16-23(4)42)15-22(3)34(44)38-24(5)36(46)41(6)31(18-28-27-12-7-8-13-29(27)39-33(28)37)35(45)40-30-19-32(43)47-26-11-9-10-25(30)17-26/h7-14,17,21-24,30-31,39,42H,15-16,18-19H2,1-6H3,(H,38,44)(H,40,45)/b20-14+/t21-,22-,23-,24-,30?,31-/m0/s1 |
InChiKey: | InChIKey=CJSIMXLUFCODBV-JUZKPSJXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.