Molecular Structure:
CAS No.:
1198413-17-0
Product Name.:
CCD No.:CCD03284246
Formula:C8 H5 Br N2 O
MolWeight:225.044
![7-BROMO-4-HYDROXY-[1,8]NAPHTHYRIDINE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 7-BROMO-4-HYDROXY-[1,8]NAPHTHYRIDINE |
| CAS： | 1198413-17-0 |
| English Synonyms： | 7-BROMO-1,8-NAPHTHYRIDIN-4-OL ; 7-BROMO-4-HYDROXY-[1,8]NAPHTHYRIDINE |
| MDL Number.： | MFCD17012594 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | c1cc(nc2c1c(ccn2)O)Br |
| InChi： | InChI=1S/C8H5BrN2O/c9-7-2-1-5-6(12)3-4-10-8(5)11-7/h1-4H,(H,10,11,12) |
| InChiKey： | InChIKey=PEXOJPNXNILGIR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
