* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GADOTERIDOL |
CAS: | 120066-54-8 |
English Synonyms: | GADOTERIDOL |
MDL Number.: | MFCD00903694 |
H bond acceptor: | 11 |
H bond donor: | 1 |
Smile: | CC(CN1CCN(CCN(CCN(CC1)CC(=O)[O-])CC(=O)[O-])CC(=O)[O-])O.[Gd+3] |
InChi: | InChI=1S/C17H32N4O7.Gd/c1-14(22)10-18-2-4-19(11-15(23)24)6-8-21(13-17(27)28)9-7-20(5-3-18)12-16(25)26;/h14,22H,2-13H2,1H3,(H,23,24)(H,25,26)(H,27,28);/q;+3/p-3 |
InChiKey: | InChIKey=DPNNNPAKRZOSMO-UHFFFAOYSA-K |
* If the product has intellectual property rights, a license granted is must or contact us.