Molecular Structure:
CAS No.:
66376-36-1
;1035437-39-8
;121268-17-5
Product Name.:
CCD No.:CCD00621911
Formula:C4 H7 D6 N O7 P2
MolWeight:255.131
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ALENDRONIC ACID-D6 |
| CAS： | 66376-36-1 ;1035437-39-8 ;121268-17-5 |
| English Synonyms： | ALENDRONIC-2,2,3,3,4,4-D6 ACID ; ALENDRONIC-D6 ACID ; ALENDRONIC ACID-D6 |
| MDL Number.： | MFCD08063600 |
| H bond acceptor： | 8 |
| H bond donor： | 6 |
| Smile： | [2H]C([2H])(C([2H])([2H])C(O)(P(=O)(O)O)P(=O)(O)O)C([2H])([2H])N |
| InChiKey： | InChIKey=null |
|
|
| Information： | 99 ATOM % D |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
