Molecular Structure:
CAS No.:
1215631-57-4
Product Name.:
CCD No.:CCD03290002
Formula:C13 H8 Cl2 D5 N3 O3
MolWeight:335.2
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | IPRODIONE-D5 |
| CAS： | 1215631-57-4 |
| English Synonyms： | IPRODIONE-D5 |
| MDL Number.： | MFCD17018957 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | [2H]c1c(c(c(c(c1N2C(=O)C(N(C2=O)C(=O)NC(C)C)([2H])[2H])[2H])Cl)Cl)[2H] |
| InChiKey： | InChIKey=null |
|
|
| Information： | 97 ATOM % D |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
