* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INDOLE-3-ALDEHYDE AZINE |
| CAS: | 1233-49-4 |
| English Synonyms: | INDOLE-3-ALDEHYDE AZINE |
| MDL Number.: | MFCD00022736 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)c(c[nH]2)/C=N/N=C/c3c[nH]c4c3cccc4 |
| InChi: | InChI=1S/C18H14N4/c1-3-7-17-15(5-1)13(9-19-17)11-21-22-12-14-10-20-18-8-4-2-6-16(14)18/h1-12,19-20H/b21-11+,22-12+ |
| InChiKey: | InChIKey=OUAMYDYQMNKPLV-XHQRYOPUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.