* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EUPROCIN |
| CAS: | 1301-42-4 |
| English Synonyms: | EUPROCIN |
| MDL Number.: | MFCD00864460 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC[C@@H]1CN2CC[C@@H]1C[C@H]2C(c3ccnc4c3cc(cc4)OCCC(C)C)O |
| InChi: | InChI=1S/C24H34N2O2/c1-4-17-15-26-11-8-18(17)13-23(26)24(27)20-7-10-25-22-6-5-19(14-21(20)22)28-12-9-16(2)3/h5-7,10,14,16-18,23-24,27H,4,8-9,11-13,15H2,1-3H3/t17-,18-,23+,24?/m1/s1 |
| InChiKey: | InChIKey=CAFOIGUDKPQBIO-KYYSLVDESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.