* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GADOVERSETAMIDE |
| CAS: | 131069-91-5 |
| English Synonyms: | GADOVERSETAMIDE |
| MDL Number.: | MFCD00867270 |
| H bond acceptor: | 15 |
| H bond donor: | 2 |
| Smile: | COCCNC(=O)CN1CCN2CCN(CC(=O)O[Gd](OC(=O)C2)OC(=O)C1)CC(=O)NCCOC |
| InChi: | InChI=1S/C20H37N5O10.Gd/c1-34-9-3-21-16(26)11-24(14-19(30)31)7-5-23(13-18(28)29)6-8-25(15-20(32)33)12-17(27)22-4-10-35-2;/h3-15H2,1-2H3,(H,21,26)(H,22,27)(H,28,29)(H,30,31)(H,32,33);/q;+3/p-3 |
| InChiKey: | InChIKey=HBEAOBRDTOXWRZ-UHFFFAOYSA-K |
* If the product has intellectual property rights, a license granted is must or contact us.