* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-ASPARTATE KALIUM |
CAS: | 14007-45-5 |
English Synonyms: | L-ASPARTATE KALIUM |
MDL Number.: | MFCD17215522 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C([C@@H](C(=O)[O-])N)C(=O)[O-].[K+].[K+] |
InChi: | InChI=1S/C4H7NO4.2K/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;/q;2*+1/p-2/t2-;;/m0../s1 |
InChiKey: | InChIKey=IKALZAKZWHFNIC-JIZZDEOASA-L |
* If the product has intellectual property rights, a license granted is must or contact us.