* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZINC DICHROMATE |
| CAS: | 14018-95-2 |
| English Synonyms: | ZINC DICHROMATE |
| MDL Number.: | MFCD00050020 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[Zn+2] |
| InChi: | InChI=1S/2Cr.7O.Zn/q;;;;;;;2*-1;+2 |
| InChiKey: | InChIKey=KHADWTWCQJVOQO-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.