* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDOLYL-1,3-DIACETATE |
CAS: | 148565-57-5 |
English Synonyms: | INDOLYL-1,3-DIACETATE |
MDL Number.: | MFCD00056014 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC(=O)Oc1cn(c2c1cccc2)OC(=O)C |
InChi: | InChI=1S/C12H11NO4/c1-8(14)16-12-7-13(17-9(2)15)11-6-4-3-5-10(11)12/h3-7H,1-2H3 |
InChiKey: | InChIKey=BFOSGUOOSPMQOE-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.