* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-TYR-SER-OH |
| CAS: | 20448-71-9 |
| English Synonyms: | Z-L-TYROSYL-L-SERINE ; Z-TYR-SER-OH |
| MDL Number.: | MFCD00191169 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | c1ccc(cc1)COC(=O)N[C@@H](Cc2ccc(cc2)O)C(=O)N[C@@H](CO)C(=O)O |
| InChi: | InChI=1S/C20H22N2O7/c23-11-17(19(26)27)21-18(25)16(10-13-6-8-15(24)9-7-13)22-20(28)29-12-14-4-2-1-3-5-14/h1-9,16-17,23-24H,10-12H2,(H,21,25)(H,22,28)(H,26,27)/t16-,17-/m0/s1 |
| InChiKey: | InChIKey=LZMMFOXOCHALJU-IRXDYDNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.