* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL (3R)-3-METHYLPENTANOATE |
| CAS: | 2177-78-8 |
| English Synonyms: | METHYL (3R)-3-METHYLPENTANOATE |
| MDL Number.: | MFCD09263283 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC[C@@H](C)CC(=O)OC |
| InChi: | InChI=1S/C7H14O2/c1-4-6(2)5-7(8)9-3/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChiKey: | InChIKey=FHASOOYJUZKVFW-ZCFIWIBFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.