Molecular Structure:
CAS No.:
1189426-07-0
;29094-61-9
Product Name.:
CCD No.:CCD00692317
Formula:C21 H16 D11 N5 O4 S
MolWeight:456.608
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | GLIPIZIDE-D11 |
| CAS： | 1189426-07-0 ;29094-61-9 |
| English Synonyms： | GLIPIZIDE-D11 (CYCLOHEXYL-D11) ; GLIPIZIDE-D11 |
| MDL Number.： | MFCD08705009 |
| H bond acceptor： | 9 |
| H bond donor： | 3 |
| Smile： | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])NC(=O)NS(=O)(=O)c2ccc(cc2)CCNC(=O)c3cnc(cn3)C)([2H])[2H])([2H])[2H])[2H] |
| InChiKey： | InChIKey=null |
|
|
| Information： | 98 ATOM % D |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
