* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITEXIN-4'-RHAMNOSIDE |
| CAS: | 32426-34-9 |
| English Synonyms: | VITEXIN-4'-RHAMNOSIDE |
| MDL Number.: | MFCD00017469 |
| H bond acceptor: | 14 |
| H bond donor: | 9 |
| Smile: | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)Oc2ccc(cc2)c3cc(=O)c4c(cc(c(c4o3)[C@H]5C([C@H](C([C@H](O5)CO)O)O)O)O)O)O)O)O |
| InChi: | InChI=1S/C27H30O14/c1-9-19(32)21(34)24(37)27(38-9)39-11-4-2-10(3-5-11)15-7-14(31)17-12(29)6-13(30)18(25(17)40-15)26-23(36)22(35)20(33)16(8-28)41-26/h2-7,9,16,19-24,26-30,32-37H,8H2,1H3/t9-,16+,19-,20?,21+,22-,23?,24+,26-,27-/m0/s1 |
| InChiKey: | InChIKey=ZIIBNXKQZAUBRD-GJTSWFOFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.