* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISO-CAMPHANE |
CAS: | 473-19-8 ;38451-93-3 |
English Synonyms: | ISO-CAMPHANE |
MDL Number.: | MFCD09753373 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1[C@H]2CC[C@H](C2)C1(C)C |
InChi: | InChI=1S/C10H18/c1-7-8-4-5-9(6-8)10(7,2)3/h7-9H,4-6H2,1-3H3/t7?,8-,9+/m0/s1 |
InChiKey: | InChIKey=XETQTCAMTVHYPO-SXNZSPLWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.