* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PSN 375963 HYDROCHLORIDE |
| CAS: | 388575-52-8 |
| English Synonyms: | PSN 375963 HYDROCHLORIDE |
| MDL Number.: | MFCD12828763 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCCCC1CCC(CC1)c2nc(no2)c3ccncc3.Cl |
| InChi: | InChI=1S/C17H23N3O.ClH/c1-2-3-4-13-5-7-15(8-6-13)17-19-16(20-21-17)14-9-11-18-12-10-14;/h9-13,15H,2-8H2,1H3;1H |
| InChiKey: | InChIKey=ONDLSENXTCSHGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.