* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ANTIOXIDANT ZKF |
CAS: | 4066-02-8 |
English Synonyms: | ANTIOXIDANT ZKF |
MDL Number.: | MFCD01763348 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | Cc1cc(c(cc1C2CCCCC2)O)Cc3cc(c(cc3O)C4CCCCC4)C |
InChi: | InChI=1S/C27H36O2/c1-18-13-22(26(28)16-24(18)20-9-5-3-6-10-20)15-23-14-19(2)25(17-27(23)29)21-11-7-4-8-12-21/h13-14,16-17,20-21,28-29H,3-12,15H2,1-2H3 |
InChiKey: | InChIKey=CSYXLHVZIABNNQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.