* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZINC TARTRATE |
CAS: | 22570-08-7 ;551-64-4 |
English Synonyms: | ZINC TARTRATE |
MDL Number.: | MFCD00054443 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C1(C(C(=O)O[Zn]OC1=O)O)O |
InChi: | InChI=1S/C4H6O6.Zn/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 |
InChiKey: | InChIKey=VRGNUPCISFMPEM-UHFFFAOYSA-L |
Property |
|
Comments: | ASSAY METHOD: T |
Specification: | EXTRA PURE |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.