* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINAZOLINE-2,4(1H,3H)-DITHIONE |
| CAS: | 5993-69-1 |
| English Synonyms: | QUINAZOLINE-2,4(1H,3H)-DITHIONE ; 2,4(1H,3H)-QUINAZOLINEDITHIONE ; ZERENEX E/6030667 |
| MDL Number.: | MFCD00174696 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)c(=S)[nH]c(=S)[nH]2 |
| InChi: | InChI=1S/C8H6N2S2/c11-7-5-3-1-2-4-6(5)9-8(12)10-7/h1-4H,(H2,9,10,11,12) |
| InChiKey: | InChIKey=ZIOAGVULHUBXBS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.