* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-PHENYLPURINE |
| CAS: | 6505-01-7 |
| English Synonyms: | 6-PHENYL-1H-PURINE ; 6-PHENYLPURINE |
| MDL Number.: | MFCD09999139 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)c2c-3ncnc3nc[nH]2 |
| InChi: | InChI=1S/C11H8N4/c1-2-4-8(5-3-1)9-10-11(14-6-12-9)15-7-13-10/h1-7H,(H,12,13,14,15) |
| InChiKey: | InChIKey=YTQFOPPEYLNRJT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.