* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XAMOTEROL |
CAS: | 81801-12-9 ;73210-73-8 |
English Synonyms: | XAMOTEROL |
MDL Number.: | MFCD00661103 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | c1cc(ccc1O)OCC(CNCCNC(=O)N2CCOCC2)O |
InChi: | InChI=1S/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) |
InChiKey: | InChIKey=DXPOSRCHIDYWHW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.