* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JP1302 |
CAS: | 80259-18-3 |
English Synonyms: | JP1302 |
MDL Number.: | MFCD00552786 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CN1CCN(CC1)c2ccc(cc2)Nc3c4ccccc4nc5c3cccc5 |
InChi: | InChI=1S/C24H24N4/c1-27-14-16-28(17-15-27)19-12-10-18(11-13-19)25-24-20-6-2-4-8-22(20)26-23-9-5-3-7-21(23)24/h2-13H,14-17H2,1H3,(H,25,26) |
InChiKey: | InChIKey=QZKGUNQLVFEEBA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.