Molecular Structure:
CAS No.:
83-98-7
Product Name.:
CCD No.:CCD00782763
Formula:C18 H20 D3 N O
MolWeight:272.404
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ORPHENADRINE-D3 |
| CAS： | 83-98-7 |
| English Synonyms： | ORPHENADRINE-D3 |
| MDL Number.： | MFCD09752135 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | [2H]C([2H])([2H])N(C)CCOC(c1ccccc1)c2ccccc2C |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
