* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-ETHYL-2-METHYL-9H-PURINE |
| CAS: | 860410-56-6 |
| English Synonyms: | 9H-PURINE, 8-ETHYL-2-METHYL- ; 8-ETHYL-2-METHYL-9H-PURINE |
| MDL Number.: | MFCD16878404 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCc1[nH]c2c(n1)cnc(n2)C |
| InChi: | InChI=1S/C8H10N4/c1-3-7-11-6-4-9-5(2)10-8(6)12-7/h4H,3H2,1-2H3,(H,9,10,11,12) |
| InChiKey: | InChIKey=WGDOLFCLLALKDM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.