* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYROCATECHOL, 4,5-DIAMINO-, DI-HCL |
CAS: | 861584-13-6 |
English Synonyms: | PYROCATECHOL, 4,5-DIAMINO-, DI-HCL |
MDL Number.: | MFCD17018271 |
H bond acceptor: | 4 |
H bond donor: | 4 |
Smile: | c1c(c(cc(c1O)O)N)N.Cl.Cl |
InChi: | InChI=1S/C6H8N2O2.2ClH/c7-3-1-5(9)6(10)2-4(3)8;;/h1-2,9-10H,7-8H2;2*1H |
InChiKey: | InChIKey=BMBVYHMBHPYJTI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.