* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,7-DIAZASPIRO[4.5]DECAN-1-ONE |
CAS: | 887118-43-6 |
English Synonyms: | 2,7-DIAZASPIRO[4.5]DECAN-1-ONE ; 2,7-DIAZA-SPIRO[4.5]DECAN-1-ONE |
MDL Number.: | MFCD12406550 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C1CC2(CCNC2=O)CNC1 |
InChi: | InChI=1S/C8H14N2O/c11-7-8(3-5-10-7)2-1-4-9-6-8/h9H,1-6H2,(H,10,11) |
InChiKey: | InChIKey=KIMWNWBXVWTJDT-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.