* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BIFEMELANE |
| CAS: | 90293-01-9 |
| English Synonyms: | BIFEMELANE |
| MDL Number.: | MFCD00661085 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CNCCCCOc1ccccc1Cc2ccccc2 |
| InChi: | InChI=1S/C18H23NO/c1-19-13-7-8-14-20-18-12-6-5-11-17(18)15-16-9-3-2-4-10-16/h2-6,9-12,19H,7-8,13-15H2,1H3 |
| InChiKey: | InChIKey=QSQQPMHPCBLLGX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.