* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1579 |
CAS: | 944898-23-1 |
English Synonyms: | ABBYPHARMA AP-10-1579 |
MDL Number.: | MFCD16988146 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | NCC1=NC(=CC(=O)N1)C(O)=O |
InChi: | InChI=1S/C6H7N3O3/c7-2-4-8-3(6(11)12)1-5(10)9-4/h1H,2,7H2,(H,11,12)(H,8,9,10) |
InChiKey: | InChIKey=ULVOMLXFCTXXPX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.