* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BENZYL-1-PHENYL-1,3,8-TRIAZA-SPIRO[4.5]DECAN-4-ONE |
| CAS: | 974-41-4 |
| English Synonyms: | 8-BENZYL-1-PHENYL-1,3,8-TRIAZA-SPIRO[4.5]DECAN-4-ONE |
| MDL Number.: | MFCD02929369 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)CN2CCC3(CC2)C(=O)NCN3c4ccccc4 |
| InChi: | InChI=1S/C20H23N3O/c24-19-20(23(16-21-19)18-9-5-2-6-10-18)11-13-22(14-12-20)15-17-7-3-1-4-8-17/h1-10H,11-16H2,(H,21,24) |
| InChiKey: | InChIKey=QMECPMOWMNRLSL-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.