* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Butanamine, 4-(2-bromophenoxy)- |
CAS: | 1000534-99-5 |
English Synonyms: | 1-BUTANAMINE, 4-(2-BROMOPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=C(OCCCCN)C=CC=C1 |
InChi: | InChI=1S/C10H14BrNO/c11-9-5-1-2-6-10(9)13-8-4-3-7-12/h1-2,5-6H,3-4,7-8,12H2 |
InChiKey: | InChIKey=NVLOSMXRLGEFII-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.