* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHENOL, 2-[(1E)-2-(2-BROMOPHENYL)ETHENYL]-4-CHLORO-, 1-ACETATE |
| CAS: | 1000890-04-9 |
| English Synonyms: | PHENOL, 2-[(1E)-2-(2-BROMOPHENYL)ETHENYL]-4-CHLORO-, 1-ACETATE |
| MDL Number.: | MFCD17019205 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(=O)Oc1ccc(cc1/C=C/c2ccccc2Br)Cl |
| InChi: | InChI=1S/C16H12BrClO2/c1-11(19)20-16-9-8-14(18)10-13(16)7-6-12-4-2-3-5-15(12)17/h2-10H,1H3/b7-6+ |
| InChiKey: | InChIKey=RZELIUUDCHQPEY-VOTSOKGWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.