* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (6S,7S)-2-Amino-4,5,6,7-tetrahydro-6-(propylamino)-7-benzothiazolol |
CAS: | 1001648-71-0 |
English Synonyms: | (6S,7S)-2-AMINO-4,5,6,7-TETRAHYDRO-6-(PROPYLAMINO)-7-BENZOTHIAZOLOL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NC=1SC2=C(N1)CC[C@@H]([C@@H]2O)NCCC |
InChi: | InChI=1S/C10H17N3OS/c1-2-5-12-6-3-4-7-9(8(6)14)15-10(11)13-7/h6,8,12,14H,2-5H2,1H3,(H2,11,13)/t6-,8-/m0/s1 |
InChiKey: | InChIKey=UWNDKVURLHPSSG-XPUUQOCRSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.