* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PIPERDIAL |
CAS: | 100288-36-6 |
English Synonyms: | PIPERDIAL |
MDL Number.: | MFCD02751695 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC1C=C(C(C(C2C1CC(C2)(C)C)O)C=O)C=O |
InChi: | InChI=1S/C15H22O3/c1-9-4-10(7-16)13(8-17)14(18)12-6-15(2,3)5-11(9)12/h4,7-9,11-14,18H,5-6H2,1-3H3 |
InChiKey: | InChIKey=XXMVNOYKYOCDTD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.