* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,1-DIETHYLCYCLOPROPANE |
| CAS: | 1003-19-6 |
| English Synonyms: | 1,1-DIETHYLCYCLOPROPANE |
| MDL Number.: | MFCD00045397 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CCC1(CC1)CC |
| InChi: | InChI=1S/C7H14/c1-3-7(4-2)5-6-7/h3-6H2,1-2H3 |
| InChiKey: | InChIKey=VUROAZUCSQPSOK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.