* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUINAZOPYRINE |
CAS: | 100330-91-4 |
English Synonyms: | QUINAZOPYRINE |
MDL Number.: | MFCD01693099 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1c(c(=O)n(n1C)c2ccccc2)Nc3c4ccccc4ncn3 |
InChi: | InChI=1S/C19H17N5O/c1-13-17(19(25)24(23(13)2)14-8-4-3-5-9-14)22-18-15-10-6-7-11-16(15)20-12-21-18/h3-12H,1-2H3,(H,20,21,22) |
InChiKey: | InChIKey=NVIVNOZMKBAWMX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.