* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Phenol, 2-(1H-imidazol-1-yl)- |
CAS: | 10041-04-0 |
English Synonyms: | PHENOL, 2-(1H-IMIDAZOL-1-YL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N1(C=NC=C1)C1=C(C=CC=C1)O |
InChi: | InChI=1S/C9H8N2O/c12-9-4-2-1-3-8(9)11-6-5-10-7-11/h1-7,12H |
InChiKey: | InChIKey=POIGXVYPRGOWQD-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.