* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VIVAKORFEN |
| CAS: | 100500-09-2 |
| English Synonyms: | VIVAKORFEN |
| MDL Number.: | MFCD01728946 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCN(CC)CCOc1ccc2c3ccc(nc3ccc2n1)OCCN(CC)CC.Cl.Cl |
| InChi: | InChI=1S/C24H34N4O2.2ClH/c1-5-27(6-2)15-17-29-23-13-9-19-20-10-14-24(30-18-16-28(7-3)8-4)26-22(20)12-11-21(19)25-23;;/h9-14H,5-8,15-18H2,1-4H3;2*1H |
| InChiKey: | InChIKey=ZWICEUJLNPYZII-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.