* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Pyrrolidinemethanol, 1-(1-methylethyl)-, (2S)- |
CAS: | 1005337-07-4 |
English Synonyms: | 2-PYRROLIDINEMETHANOL, 1-(1-METHYLETHYL)-, (2S)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(C)N1[C@@H](CCC1)CO |
InChi: | InChI=1S/C8H17NO/c1-7(2)9-5-3-4-8(9)6-10/h7-8,10H,3-6H2,1-2H3/t8-/m0/s1 |
InChiKey: | InChIKey=XJCUYISZYNEDKN-QMMMGPOBSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.