* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-NITRO-8-NITROSOPYRENE |
CAS: | 100593-23-5 |
English Synonyms: | 1-NITRO-8-NITROSOPYRENE |
MDL Number.: | MFCD01692965 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1cc2ccc(c3c2c4c1ccc(c4cc3)N=O)[N+](=O)[O-] |
InChi: | InChI=1S/C16H8N2O3/c19-17-13-7-3-9-1-2-10-4-8-14(18(20)21)12-6-5-11(13)15(9)16(10)12/h1-8H |
InChiKey: | InChIKey=PAJDGJYLNJGDDA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.