* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-CYCLOHEXYL-3H-1,3-BENZODIAZOL-2-ONE |
CAS: | 100615-14-3 |
English Synonyms: | 1-CYCLOHEXYL-3H-1,3-BENZODIAZOL-2-ONE |
MDL Number.: | MFCD02271220 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)[nH]c(=O)n2C3CCCCC3 |
InChi: | InChI=1S/C13H16N2O/c16-13-14-11-8-4-5-9-12(11)15(13)10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2,(H,14,16) |
InChiKey: | InChIKey=KQPGCWWXPPKEOL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.