* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ASAPHAN |
| CAS: | 10065-57-3 |
| English Synonyms: | ASAPHAN |
| MDL Number.: | MFCD01674216 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc2ccc(cc2)N(CCCl)CCCl)NC(=O)C |
| InChi: | InChI=1S/C26H33Cl2N3O4/c1-3-35-26(34)24(18-20-7-5-4-6-8-20)30-25(33)23(29-19(2)32)17-21-9-11-22(12-10-21)31(15-13-27)16-14-28/h4-12,23-24H,3,13-18H2,1-2H3,(H,29,32)(H,30,33)/t23-,24-/m0/s1 |
| InChiKey: | InChIKey=SPTPIOQJNAVKCR-ZEQRLZLVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.