* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9(R)-HODE |
CAS: | 10075-11-3 |
English Synonyms: | 9R-HYDROXY-10E,12Z-OCTADECADIENOIC ACID ; 9(R)-HODE |
MDL Number.: | MFCD00084832 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCCC/C=C\C=C\[C@@H](CCCCCCCC(=O)O)O |
InChi: | InChI=1S/C18H32O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14,17,19H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6-,14-11+/t17-/m0/s1 |
InChiKey: | InChIKey=NPDSHTNEKLQQIJ-WXUVIADPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.