* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IMIPRAMINE PAMOATE |
| CAS: | 10075-24-8 |
| English Synonyms: | IMIPRAMINE PAMOATE |
| MDL Number.: | MFCD00216028 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | CN(C)CCCN1c2ccccc2CCc3c1cccc3.c1ccc2c(c1)cc(c(c2Cc3c4ccccc4cc(c3O)C(=O)O)O)C(=O)O |
| InChi: | InChI=1S/C23H16O6.C19H24N2/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;1-20(2)14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21/h1-10,24-25H,11H2,(H,26,27)(H,28,29);3-6,8-11H,7,12-15H2,1-2H3 |
| InChiKey: | InChIKey=SBDXQUVAAJKLDH-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.