* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-HYDROXY-19-NOR-1,3,5(10)-CHOLATRIEN-24-OIC ACID |
CAS: | 100772-18-7 |
English Synonyms: | 3-HYDROXY-19-NOR-1,3,5(10)-CHOLATRIEN-24-OIC ACID |
MDL Number.: | MFCD02751691 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(CCC(=O)O)C1CCC2C1(CCC3C2CCc4c3ccc(c4)O)C |
InChi: | InChI=1S/C23H32O3/c1-14(3-10-22(25)26)20-8-9-21-19-6-4-15-13-16(24)5-7-17(15)18(19)11-12-23(20,21)2/h5,7,13-14,18-21,24H,3-4,6,8-12H2,1-2H3,(H,25,26) |
InChiKey: | InChIKey=XMOYAJSUUCZZLU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.