* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WIN 3618 |
CAS: | 100811-85-6 |
English Synonyms: | WIN 3618 |
MDL Number.: | MFCD01660469 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCN(CC)CCCOC(=O)c1ccc(cc1)N.OP(=O)(O)O |
InChi: | InChI=1S/C14H22N2O2.H3O4P/c1-3-16(4-2)10-5-11-18-14(17)12-6-8-13(15)9-7-12;1-5(2,3)4/h6-9H,3-5,10-11,15H2,1-2H3;(H3,1,2,3,4) |
InChiKey: | InChIKey=IUOITCODAKJFHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.