* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IBD 78 |
CAS: | 10083-53-1 |
English Synonyms: | IBD 78 |
MDL Number.: | MFCD01659134 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CNCC/C=C/1\c2ccccc2CCc3c1ccs3 |
InChi: | InChI=1S/C17H19NS/c1-18-11-4-7-15-14-6-3-2-5-13(14)8-9-17-16(15)10-12-19-17/h2-3,5-7,10,12,18H,4,8-9,11H2,1H3/b15-7+ |
InChiKey: | InChIKey=RDBMZAMQBNYOIJ-VIZOYTHASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.