* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N'-METHYL-N(4)-AMINOCYTIDINE |
| CAS: | 100997-69-1 |
| English Synonyms: | N'-METHYL-N(4)-AMINOCYTIDINE |
| MDL Number.: | MFCD01689057 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | CNNc1ccn(c(=O)n1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
| InChi: | InChI=1S/C10H16N4O5/c1-11-13-6-2-3-14(10(18)12-6)9-8(17)7(16)5(4-15)19-9/h2-3,5,7-9,11,15-17H,4H2,1H3,(H,12,13,18)/t5-,7-,8-,9-/m1/s1 |
| InChiKey: | InChIKey=BCINLQKXGCKFCA-ZOQUXTDFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.