* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-NITRO-6-NITROSOPYRENE |
CAS: | 101043-65-6 |
English Synonyms: | 1-NITRO-6-NITROSOPYRENE |
MDL Number.: | MFCD01692964 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1cc2c(ccc3c2c4c1ccc(c4cc3)[N+](=O)[O-])N=O |
InChi: | InChI=1S/C16H8N2O3/c19-17-13-7-3-9-2-6-12-14(18(20)21)8-4-10-1-5-11(13)15(9)16(10)12/h1-8H |
InChiKey: | InChIKey=WWKLDZDOXNNLAM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.