* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-ETHOXY-1-METHYL-1H-INDOLE |
| CAS: | 1011-49-0 |
| English Synonyms: | 2-ETHOXY-1-METHYL-1H-INDOLE ; 1H-INDOLE, 2-ETHOXY-1-METHYL- |
| MDL Number.: | MFCD01463480 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCOc1cc2ccccc2n1C |
| InChi: | InChI=1S/C11H13NO/c1-3-13-11-8-9-6-4-5-7-10(9)12(11)2/h4-8H,3H2,1-2H3 |
| InChiKey: | InChIKey=NPZRCEMZSGEWOB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.